CAS 20244-61-5 appears in our catalog under these names: 2,4,4,6-Tetrabromo-2,5-cyclohexadienone, 97%, 2,4,4,6–Tetrabromo–2,5–cyclohexadienone, 2,4,4,6-Tetrabromo-2,5-cyclohexadienone, >97.0%(T), 2,4,4,6-Tetrabromo-2,5-cyclohexadienone 97%, 2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE,. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 10g, 100g.
2,4,4,6-tetrabromocyclohexa-2,5-dien-1-one (CAS 20244-61-5) is a chemical compound with the molecular formula C6H2Br4O and a molecular weight of 409.69 g/mol. IUPAC name: 2,4,4,6-tetrabromocyclohexa-2,5-dien-1-one. InChIKey: NJQJGRGGIUNVAB-UHFFFAOYSA-N.
| Molecular formula | C6H2Br4O |
|---|---|
| Molecular weight | 409.69 g/mol |
| IUPAC name | 2,4,4,6-tetrabromocyclohexa-2,5-dien-1-one |
| InChIKey | NJQJGRGGIUNVAB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)C(=CC1(Br)Br)Br)Br |
Computed by PubChem (NCBI)