CAS 1440519-75-4 is the registry number for 2-Chloro-7,7-dimethyl-6,7-dihydro-5H-pyrrolo(3,4-b)pyridin-5-one, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one (CAS 1440519-75-4) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 2-chloro-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one. InChIKey: CGQDOSSFUZYSDB-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 2-chloro-7,7-dimethyl-6H-pyrrolo[3,4-b]pyridin-5-one |
| InChIKey | CGQDOSSFUZYSDB-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=N2)Cl)C(=O)N1)C |
Computed by PubChem (NCBI)