CAS 1440526-46-4 is the registry number for 2,4-Diiodo-5-trifluoromethyl-phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,4-diiodo-5-(trifluoromethyl)phenol (CAS 1440526-46-4) is a chemical compound with the molecular formula C7H3F3I2O and a molecular weight of 413.90 g/mol. IUPAC name: 2,4-diiodo-5-(trifluoromethyl)phenol. InChIKey: ICJBBXJQOXWUPE-UHFFFAOYSA-N.
| Molecular formula | C7H3F3I2O |
|---|---|
| Molecular weight | 413.90 g/mol |
| IUPAC name | 2,4-diiodo-5-(trifluoromethyl)phenol |
| InChIKey | ICJBBXJQOXWUPE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)I)I)C(F)(F)F |
Computed by PubChem (NCBI)