CAS 169255-50-9 appears in our catalog under these names: 2,6-Diiodo-4-(trifluoromethyl)phenol, 95%, 2,6–Diiodo–4–(trifluoromethyl)phenol, 2,6-Diiodo-4-(trifluoromethyl)phenol 95%, 2,6-Diiodo-4-(trifluoromethyl)phenol, 95%, 95%, 2,6-Diiodo-4-(trifluoromethyl)phenol. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
2,6-diiodo-4-(trifluoromethyl)phenol (CAS 169255-50-9) is a chemical compound with the molecular formula C7H3F3I2O and a molecular weight of 413.90 g/mol. IUPAC name: 2,6-diiodo-4-(trifluoromethyl)phenol. InChIKey: PFTYBCBURDKLTH-UHFFFAOYSA-N.
| Molecular formula | C7H3F3I2O |
|---|---|
| Molecular weight | 413.90 g/mol |
| IUPAC name | 2,6-diiodo-4-(trifluoromethyl)phenol |
| InChIKey | PFTYBCBURDKLTH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)O)I)C(F)(F)F |
Computed by PubChem (NCBI)