CAS 144060-89-9 appears in our catalog under these names: 4-(Propan-2-yloxy)benzene-1-carbothioamide, 95%, 4-(Propan-2-yloxy)benzene-1-carbothioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-propan-2-yloxybenzenecarbothioamide (CAS 144060-89-9) is a chemical compound with the molecular formula C10H13NOS and a molecular weight of 195.28 g/mol. IUPAC name: 4-propan-2-yloxybenzenecarbothioamide. InChIKey: TYUMBOSCTNGSIR-UHFFFAOYSA-N.
| Molecular formula | C10H13NOS |
|---|---|
| Molecular weight | 195.28 g/mol |
| IUPAC name | 4-propan-2-yloxybenzenecarbothioamide |
| InChIKey | TYUMBOSCTNGSIR-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(=S)N |
Computed by PubChem (NCBI)