Products 144062-35-1

CAS 144062-35-1 is the registry number for 1-(Dimethoxymethyl)-2,4-difluorobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-(dimethoxymethyl)-2,4-difluorobenzene (CAS 144062-35-1) is a chemical compound with the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. IUPAC name: 1-(dimethoxymethyl)-2,4-difluorobenzene. InChIKey: BSCXOIPRVSWFFT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10F2O2
Molecular weight188.17 g/mol
IUPAC name1-(dimethoxymethyl)-2,4-difluorobenzene
InChIKeyBSCXOIPRVSWFFT-UHFFFAOYSA-N
SMILESCOC(C1=C(C=C(C=C1)F)F)OC

Computed by PubChem (NCBI)