Products 1441177-19-0

CAS 1441177-19-0 is the registry number for 1-Benzyl 4-(tert-butyl) (S)-2-vinylpiperazine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-benzyl 4-O-tert-butyl (2S)-2-ethenylpiperazine-1,4-dicarboxylate (CAS 1441177-19-0) is a chemical compound with the molecular formula C19H26N2O4 and a molecular weight of 346.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl (2S)-2-ethenylpiperazine-1,4-dicarboxylate. InChIKey: SQYQKIDYSFDHCG-INIZCTEOSA-N.

Identity
Molecular formulaC19H26N2O4
Molecular weight346.4 g/mol
IUPAC name1-O-benzyl 4-O-tert-butyl (2S)-2-ethenylpiperazine-1,4-dicarboxylate
InChIKeySQYQKIDYSFDHCG-INIZCTEOSA-N
SMILESCC(C)(C)OC(=O)N1CCN([C@H](C1)C=C)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)