CAS 1441177-19-0 is the registry number for 1-Benzyl 4-(tert-butyl) (S)-2-vinylpiperazine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-benzyl 4-O-tert-butyl (2S)-2-ethenylpiperazine-1,4-dicarboxylate (CAS 1441177-19-0) is a chemical compound with the molecular formula C19H26N2O4 and a molecular weight of 346.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl (2S)-2-ethenylpiperazine-1,4-dicarboxylate. InChIKey: SQYQKIDYSFDHCG-INIZCTEOSA-N.
| Molecular formula | C19H26N2O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-tert-butyl (2S)-2-ethenylpiperazine-1,4-dicarboxylate |
| InChIKey | SQYQKIDYSFDHCG-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)C=C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)