Products 1788041-44-0

CAS 1788041-44-0 is the registry number for 7-Benzyl 3-tert-butyl 3,7-diazabicyclo[4.2.0]octane-3,7-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

7-O-benzyl 3-O-tert-butyl 3,7-diazabicyclo[4.2.0]octane-3,7-dicarboxylate (CAS 1788041-44-0) is a chemical compound with the molecular formula C19H26N2O4 and a molecular weight of 346.4 g/mol. IUPAC name: 7-O-benzyl 3-O-tert-butyl 3,7-diazabicyclo[4.2.0]octane-3,7-dicarboxylate. InChIKey: MYMIEWSPEXXWTG-UHFFFAOYSA-N.

Identity
Molecular formulaC19H26N2O4
Molecular weight346.4 g/mol
IUPAC name7-O-benzyl 3-O-tert-butyl 3,7-diazabicyclo[4.2.0]octane-3,7-dicarboxylate
InChIKeyMYMIEWSPEXXWTG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2C(C1)CN2C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)