CAS 14415-44-2 appears in our catalog under these names: 6-Amino-2H-chromen-2-one, 6-Amino-chromen-2-one 97%, 6-Amino-chromen-2-one, 99%, 6-Amino-2H-chromen-2-one, 98%, 6-Amino-2H-chromen-2-one, >98.0%(HPLC)(T). Offered by: Biosynth, Ambeed, Fluorochem, Combi-blocks, TCI. Available pack sizes: 5g, 2g, 10g, 25g, 50g, 100mg, 250mg, 1g.
6-aminochromen-2-one (CAS 14415-44-2) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 6-aminochromen-2-one. InChIKey: ZOJAINJCZSVZGW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 6-aminochromen-2-one |
| InChIKey | ZOJAINJCZSVZGW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1N |
Computed by PubChem (NCBI)