Products 1441961-74-5
CAS 1441961-74-5 is the registry number for A1AR antagonist 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-4-(3-hydroxyphenyl)-6-phenylpyrimidine-5-carbonitrile (CAS 1441961-74-5) is a chemical compound with the molecular formula C17H12N4O and a molecular weight of 288.30 g/mol. IUPAC name: 2-amino-4-(3-hydroxyphenyl)-6-phenylpyrimidine-5-carbonitrile. InChIKey: HLNXFOVLLWEQOT-UHFFFAOYSA-N.
| Molecular formula | C17H12N4O |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | 2-amino-4-(3-hydroxyphenyl)-6-phenylpyrimidine-5-carbonitrile |
| InChIKey | HLNXFOVLLWEQOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NC(=N2)N)C3=CC(=CC=C3)O)C#N |
Computed by PubChem (NCBI)
Synonyms:
A1AR antagonist 2, orb1689445