Products 933949-57-6
CAS 933949-57-6 is the registry number for 2-amino-1-(1-aza-2-(3-phenoxyphenyl)vinyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-2-amino-3-[(3-phenoxyphenyl)methylideneamino]but-2-enedinitrile (CAS 933949-57-6) is a chemical compound with the molecular formula C17H12N4O and a molecular weight of 288.30 g/mol. IUPAC name: (Z)-2-amino-3-[(3-phenoxyphenyl)methylideneamino]but-2-enedinitrile. InChIKey: ZMOSKHLHBKWQNV-MXNUEDNJSA-N.
| Molecular formula | C17H12N4O |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | (Z)-2-amino-3-[(3-phenoxyphenyl)methylideneamino]but-2-enedinitrile |
| InChIKey | ZMOSKHLHBKWQNV-MXNUEDNJSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)