Products 144252-16-4

CAS 144252-16-4 is the registry number for 5-Naphthalen-2-yl-1-phenyl-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-naphthalen-2-yl-1-phenylpyrazole-3-carboxylic acid (CAS 144252-16-4) is a chemical compound with the molecular formula C20H14N2O2 and a molecular weight of 314.3 g/mol. IUPAC name: 5-naphthalen-2-yl-1-phenylpyrazole-3-carboxylic acid. InChIKey: FPCDSWNFZGRAOI-UHFFFAOYSA-N.

Identity
Molecular formulaC20H14N2O2
Molecular weight314.3 g/mol
IUPAC name5-naphthalen-2-yl-1-phenylpyrazole-3-carboxylic acid
InChIKeyFPCDSWNFZGRAOI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=CC(=N2)C(=O)O)C3=CC4=CC=CC=C4C=C3

Computed by PubChem (NCBI)