CAS 1799442-82-2 is the registry number for (E)-2-(4-(1H-Imidazol-4-yl)styryl)-1h-indene-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-[(E)-2-[4-(1H-imidazol-5-yl)phenyl]ethenyl]indene-1,3-dione (CAS 1799442-82-2) is a chemical compound with the molecular formula C20H14N2O2 and a molecular weight of 314.3 g/mol. IUPAC name: 2-[(E)-2-[4-(1H-imidazol-5-yl)phenyl]ethenyl]indene-1,3-dione. InChIKey: PGNRDVWYHFRGIV-JXMROGBWSA-N.
| Molecular formula | C20H14N2O2 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 2-[(E)-2-[4-(1H-imidazol-5-yl)phenyl]ethenyl]indene-1,3-dione |
| InChIKey | PGNRDVWYHFRGIV-JXMROGBWSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)/C=C/C3=CC=C(C=C3)C4=CN=CN4 |
Computed by PubChem (NCBI)