Products 1443110-14-2
CAS 1443110-14-2 is the registry number for 2-(2,2,5,5-tetraMethyl-2,5-dihydrofuran-3-yl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4,4,5,5-tetramethyl-2-(2,2,5,5-tetramethylfuran-3-yl)-1,3,2-dioxaborolane (CAS 1443110-14-2) is a chemical compound with the molecular formula C14H25BO3 and a molecular weight of 252.16 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,2,5,5-tetramethylfuran-3-yl)-1,3,2-dioxaborolane. InChIKey: RKTSNCZHMZBODJ-UHFFFAOYSA-N.
| Molecular formula | C14H25BO3 |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,2,5,5-tetramethylfuran-3-yl)-1,3,2-dioxaborolane |
| InChIKey | RKTSNCZHMZBODJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(OC2(C)C)(C)C |
Computed by PubChem (NCBI)