CAS 1006389-64-5 is the registry number for 3-Cyclohexen-1-ol, 5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 95%. Offered by: AmBeed. Available pack sizes: 1g, 100mg, 250mg.
5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-ol (CAS 1006389-64-5) is a chemical compound with the molecular formula C14H25BO3 and a molecular weight of 252.16 g/mol. IUPAC name: 5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-ol. InChIKey: UFCBGRZAURMRFS-UHFFFAOYSA-N.
| Molecular formula | C14H25BO3 |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | 5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-ol |
| InChIKey | UFCBGRZAURMRFS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(CC(C2)O)(C)C |
Computed by PubChem (NCBI)