CAS 3057663-21-2 is the registry number for (R)-3-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl)cyclohexan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
(3R)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexan-1-one (CAS 3057663-21-2) is a chemical compound with the molecular formula C14H25BO3 and a molecular weight of 252.16 g/mol. IUPAC name: (3R)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexan-1-one. InChIKey: PZOJUSFYZQWLSA-NSHDSACASA-N.
| Molecular formula | C14H25BO3 |
|---|---|
| Molecular weight | 252.16 g/mol |
| IUPAC name | (3R)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexan-1-one |
| InChIKey | PZOJUSFYZQWLSA-NSHDSACASA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC[C@@H]2CCCC(=O)C2 |
Computed by PubChem (NCBI)