CAS 1443110-16-4 is the registry number for 2-(2,2-Dimethyl-2,5-dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-(5,5-dimethyl-2H-furan-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1443110-16-4) is a chemical compound with the molecular formula C12H21BO3 and a molecular weight of 224.11 g/mol. IUPAC name: 2-(5,5-dimethyl-2H-furan-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SZAWSBLQUZPAMZ-UHFFFAOYSA-N.
| Molecular formula | C12H21BO3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 2-(5,5-dimethyl-2H-furan-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SZAWSBLQUZPAMZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCOC2(C)C |
Computed by PubChem (NCBI)