CAS 144317-21-5 is the registry number for H-Gln(Mtt)-OH. Offered by: Creative Peptides. Available pack sizes: 1g, 5g, 25g.
(2S)-2-amino-5-[[(4-methylphenyl)-diphenylmethyl]amino]-5-oxopentanoic acid (CAS 144317-21-5) is a chemical compound with the molecular formula C25H26N2O3 and a molecular weight of 402.5 g/mol. IUPAC name: (2S)-2-amino-5-[[(4-methylphenyl)-diphenylmethyl]amino]-5-oxopentanoic acid. InChIKey: BYQOVGDXRLOXBX-QFIPXVFZSA-N.
| Molecular formula | C25H26N2O3 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | (2S)-2-amino-5-[[(4-methylphenyl)-diphenylmethyl]amino]-5-oxopentanoic acid |
| InChIKey | BYQOVGDXRLOXBX-QFIPXVFZSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)