Products 58115-31-4
CAS 58115-31-4 appears in our catalog under these names: Aurantiamide/ 98%, Aurantiamide, Aurantiamide, 99.56%, Aurantiamide, 98%, N-((S)-1-(((S)-1-Hydroxy-3-phenylpropan-2-yl)amino)-1-oxo-3-phenylpropan-2-yl)benzamide, 98%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
N-[(2S)-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide (CAS 58115-31-4) is a chemical compound with the molecular formula C25H26N2O3 and a molecular weight of 402.5 g/mol. IUPAC name: N-[(2S)-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide. InChIKey: KSVKECXWDNCRTM-GOTSBHOMSA-N.
| Molecular formula | C25H26N2O3 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | N-[(2S)-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| InChIKey | KSVKECXWDNCRTM-GOTSBHOMSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CO)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)