CAS 1443245-02-0 appears in our catalog under these names: (2S)-1,4,4-Trimethylpyrrolidine-2-carboxylic acid, 95%, 1,4,4-Trimethyl-L-proline, 97%, (2S)-1,4,4-trimethylpyrrolidine-2-carboxylic acid, 97%, 97%, 1,4,4-Trimethyl-L-proline, L-Proline, 1,4,4-trimethyl-, 97%. Offered by: Combi-blocks, AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 500mg, Get quote.
(2S)-1,4,4-trimethylpyrrolidine-2-carboxylic acid (CAS 1443245-02-0) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (2S)-1,4,4-trimethylpyrrolidine-2-carboxylic acid. InChIKey: JEMJUABMNNBKBO-LURJTMIESA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | (2S)-1,4,4-trimethylpyrrolidine-2-carboxylic acid |
| InChIKey | JEMJUABMNNBKBO-LURJTMIESA-N |
| SMILES | CC1(C[C@H](N(C1)C)C(=O)O)C |
Computed by PubChem (NCBI)