CAS 1443303-48-7 appears in our catalog under these names: trimethyl(4-(trifluoromethoxy)phenyl)silane, 95%, 95%, 1-(Trimethylsilyl)-4-(trifluoromethoxy)benzene, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Trimethyl-[4-(trifluoromethoxy)phenyl]silane (CAS 1443303-48-7) is a chemical compound with the molecular formula C10H13F3OSi and a molecular weight of 234.29 g/mol. IUPAC name: trimethyl-[4-(trifluoromethoxy)phenyl]silane. InChIKey: GKIFQGYHQRYWHO-UHFFFAOYSA-N.
| Molecular formula | C10H13F3OSi |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | trimethyl-[4-(trifluoromethoxy)phenyl]silane |
| InChIKey | GKIFQGYHQRYWHO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=C(C=C1)OC(F)(F)F |
Computed by PubChem (NCBI)