CAS 1443345-33-2 appears in our catalog under these names: 1-(Trimethylsilyl)-2-(trifluoromethoxy)benzene, 97%, trimethyl(2-(trifluoromethoxy)phenyl)silane, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Trimethyl-[2-(trifluoromethoxy)phenyl]silane (CAS 1443345-33-2) is a chemical compound with the molecular formula C10H13F3OSi and a molecular weight of 234.29 g/mol. IUPAC name: trimethyl-[2-(trifluoromethoxy)phenyl]silane. InChIKey: ZLUHEBNHJRORIQ-UHFFFAOYSA-N.
| Molecular formula | C10H13F3OSi |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | trimethyl-[2-(trifluoromethoxy)phenyl]silane |
| InChIKey | ZLUHEBNHJRORIQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=CC=C1OC(F)(F)F |
Computed by PubChem (NCBI)