CAS 1443312-18-2 appears in our catalog under these names: (3-Fluoro-4-(trifluoromethoxy)phenyl)(methyl)sulfane, ≥95%, ≥95%, 3-Fluoro-4-(trifluoromethoxy)phenyl methyl sulfide, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
2-fluoro-4-methylsulfanyl-1-(trifluoromethoxy)benzene (CAS 1443312-18-2) is a chemical compound with the molecular formula C8H6F4OS and a molecular weight of 226.19 g/mol. IUPAC name: 2-fluoro-4-methylsulfanyl-1-(trifluoromethoxy)benzene. InChIKey: TURLMSYUXCYMGJ-UHFFFAOYSA-N.
| Molecular formula | C8H6F4OS |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 2-fluoro-4-methylsulfanyl-1-(trifluoromethoxy)benzene |
| InChIKey | TURLMSYUXCYMGJ-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=C(C=C1)OC(F)(F)F)F |
Computed by PubChem (NCBI)