CAS 1803582-26-4 is the registry number for 1-(Difluoromethoxy)-2-((difluoromethyl)sulfanyl)benzene. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(difluoromethoxy)-2-(difluoromethylsulfanyl)benzene (CAS 1803582-26-4) is a chemical compound with the molecular formula C8H6F4OS and a molecular weight of 226.19 g/mol. IUPAC name: 1-(difluoromethoxy)-2-(difluoromethylsulfanyl)benzene. InChIKey: QDAFHCNRIJJNAS-UHFFFAOYSA-N.
| Molecular formula | C8H6F4OS |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 1-(difluoromethoxy)-2-(difluoromethylsulfanyl)benzene |
| InChIKey | QDAFHCNRIJJNAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC(F)F)SC(F)F |
Computed by PubChem (NCBI)