CAS 1443329-48-3 is the registry number for Dimethyl 2-(3,5-dichlorophenyl)malonate. Offered by: TRC. Available pack sizes: 500mg.
Dimethyl 2-(3,5-dichlorophenyl)propanedioate (CAS 1443329-48-3) is a chemical compound with the molecular formula C11H10Cl2O4 and a molecular weight of 277.10 g/mol. IUPAC name: dimethyl 2-(3,5-dichlorophenyl)propanedioate. InChIKey: MYJACJGIRSMGIO-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O4 |
|---|---|
| Molecular weight | 277.10 g/mol |
| IUPAC name | dimethyl 2-(3,5-dichlorophenyl)propanedioate |
| InChIKey | MYJACJGIRSMGIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC(=C1)Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)