Products 2918946-16-2
CAS 2918946-16-2 is the registry number for ethyl 2-(2,6-dichloro-3-methoxyphenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(2,6-dichloro-3-methoxyphenyl)-2-oxoacetate (CAS 2918946-16-2) is a chemical compound with the molecular formula C11H10Cl2O4 and a molecular weight of 277.10 g/mol. IUPAC name: ethyl 2-(2,6-dichloro-3-methoxyphenyl)-2-oxoacetate. InChIKey: NRCJHPRMKSBZOD-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O4 |
|---|---|
| Molecular weight | 277.10 g/mol |
| IUPAC name | ethyl 2-(2,6-dichloro-3-methoxyphenyl)-2-oxoacetate |
| InChIKey | NRCJHPRMKSBZOD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=CC(=C1Cl)OC)Cl |
Computed by PubChem (NCBI)