CAS 1443378-59-3 appears in our catalog under these names: 7-Bromo-6-fluoroquinolin-4-ol 97%, 7-Bromo-6-fluoroquinolin-4-ol, 97%, 97%, 7-bromo-6-fluoro-1,4-dihydroquinolin-4-one, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
7-bromo-6-fluoro-1H-quinolin-4-one (CAS 1443378-59-3) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 7-bromo-6-fluoro-1H-quinolin-4-one. InChIKey: LGHGEBHGAOEYHA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 7-bromo-6-fluoro-1H-quinolin-4-one |
| InChIKey | LGHGEBHGAOEYHA-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C2C1=O)F)Br |
Computed by PubChem (NCBI)