CAS 1443429-33-1 appears in our catalog under these names: 1-(4-Ethynylphenyl)-2,2,2-trifluoroethan-1-ol, 1-(4-Ethynylphenyl)-2,2,2-trifluoroethan-1-ol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-(4-ethynylphenyl)-2,2,2-trifluoroethanol (CAS 1443429-33-1) is a chemical compound with the molecular formula C10H7F3O and a molecular weight of 200.16 g/mol. IUPAC name: 1-(4-ethynylphenyl)-2,2,2-trifluoroethanol. InChIKey: KDBTXUVLYVGRJD-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 1-(4-ethynylphenyl)-2,2,2-trifluoroethanol |
| InChIKey | KDBTXUVLYVGRJD-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C(C(F)(F)F)O |
Computed by PubChem (NCBI)