CAS 1443685-80-0 is the registry number for Atrazine 13C3 (triazine 13C3) 100 µg/mL in Acetone. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
6-chloro-4-N-ethyl-2-N-propan-2-yl-(2,4,6-13C3)1,3,5-triazine-2,4-diamine (CAS 1443685-80-0) is a chemical compound with the molecular formula C8H14ClN5 and a molecular weight of 218.66 g/mol. IUPAC name: 6-chloro-4-N-ethyl-2-N-propan-2-yl-(2,4,6-13C3)1,3,5-triazine-2,4-diamine. InChIKey: MXWJVTOOROXGIU-TTXLGWKISA-N.
| Molecular formula | C8H14ClN5 |
|---|---|
| Molecular weight | 218.66 g/mol |
| IUPAC name | 6-chloro-4-N-ethyl-2-N-propan-2-yl-(2,4,6-13C3)1,3,5-triazine-2,4-diamine |
| InChIKey | MXWJVTOOROXGIU-TTXLGWKISA-N |
| SMILES | CCN[13C]1=N[13C](=N[13C](=N1)Cl)NC(C)C |
Computed by PubChem (NCBI)