CAS 34333-27-2 is the registry number for N2-(tert-Butyl)-6-chloro-N4-methyl-1,3,5-triazine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-N-tert-butyl-6-chloro-4-N-methyl-1,3,5-triazine-2,4-diamine (CAS 34333-27-2) is a chemical compound with the molecular formula C8H14ClN5 and a molecular weight of 215.68 g/mol. IUPAC name: 2-N-tert-butyl-6-chloro-4-N-methyl-1,3,5-triazine-2,4-diamine. InChIKey: OFWPFMDXRGTHFT-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN5 |
|---|---|
| Molecular weight | 215.68 g/mol |
| IUPAC name | 2-N-tert-butyl-6-chloro-4-N-methyl-1,3,5-triazine-2,4-diamine |
| InChIKey | OFWPFMDXRGTHFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=NC(=NC(=N1)NC)Cl |
Computed by PubChem (NCBI)