Products 144386-82-3
CAS 144386-82-3 is the registry number for 7-Hydroxy-2-nitrofluoranthene. Offered by: TRC. Available pack sizes: 2,5mg.
2-nitrofluoranthen-7-ol (CAS 144386-82-3) is a chemical compound with the molecular formula C16H9NO3 and a molecular weight of 263.25 g/mol. IUPAC name: 2-nitrofluoranthen-7-ol. InChIKey: RUCSPGBEEAVCOH-UHFFFAOYSA-N.
| Molecular formula | C16H9NO3 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 2-nitrofluoranthen-7-ol |
| InChIKey | RUCSPGBEEAVCOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C(=C1)C4=C3C=CC=C4O)[N+](=O)[O-] |
Computed by PubChem (NCBI)