Products 2469736-26-1
CAS 2469736-26-1 appears in our catalog under these names: 6-Nitro-1-pyrenol-d8, 6-Nitro-1-pyrenol-d8, >95% (HPLC). Offered by: MedChemExpress, TRC. Available pack sizes: 10 mg, 1 mg, 10mg, 1mg.
2,3,4,5,7,8,9,10-octadeuterio-6-nitropyren-1-ol (CAS 2469736-26-1) is a chemical compound with the molecular formula C16H9NO3 and a molecular weight of 271.30 g/mol. IUPAC name: 2,3,4,5,7,8,9,10-octadeuterio-6-nitropyren-1-ol. InChIKey: MAVZUIFIVMZYMX-PGRXLJNUSA-N.
| Molecular formula | C16H9NO3 |
|---|---|
| Molecular weight | 271.30 g/mol |
| IUPAC name | 2,3,4,5,7,8,9,10-octadeuterio-6-nitropyren-1-ol |
| InChIKey | MAVZUIFIVMZYMX-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C2=C(C(=C(C3=C2C4=C1C(=C(C(=C4C(=C3[2H])[2H])O)[2H])[2H])[2H])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)