CAS 1443979-86-9 is the registry number for 2,2,2-Trifluoro-1-(naphthalen-1-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2,2-trifluoro-1-naphthalen-1-ylethanamine;hydrochloride (CAS 1443979-86-9) is a chemical compound with the molecular formula C12H11ClF3N and a molecular weight of 261.67 g/mol. IUPAC name: 2,2,2-trifluoro-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: OUTCIXNNERQAAI-UHFFFAOYSA-N.
| Molecular formula | C12H11ClF3N |
|---|---|
| Molecular weight | 261.67 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | OUTCIXNNERQAAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)