CAS 2222662-58-8 appears in our catalog under these names: (S)-2,2,2-Trifluoro-1-(naphthalen-1-yl)ethanamine hydrochloride, 95%, (S)–2,2,2–Trifluoro–1–(naphthalen–1–yl)ethanamine hydrochloride, (S)-2,2,2-Trifluoro-1-(naphthalen-1-yl)ethanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
(1S)-2,2,2-trifluoro-1-naphthalen-1-ylethanamine;hydrochloride (CAS 2222662-58-8) is a chemical compound with the molecular formula C12H11ClF3N and a molecular weight of 261.67 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: OUTCIXNNERQAAI-MERQFXBCSA-N.
| Molecular formula | C12H11ClF3N |
|---|---|
| Molecular weight | 261.67 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | OUTCIXNNERQAAI-MERQFXBCSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)