Products 144398-34-5
CAS 144398-34-5 is the registry number for 8-(7-Hydroxy-3,7-dimethyl-2,5-octadienyloxy)psoralen. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
9-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]furo[3,2-g]chromen-7-one (CAS 144398-34-5) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: 9-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]furo[3,2-g]chromen-7-one. InChIKey: YOQCKFCFAJIRRT-OVXNXNIRSA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 9-[(2E,5E)-7-hydroxy-3,7-dimethylocta-2,5-dienoxy]furo[3,2-g]chromen-7-one |
| InChIKey | YOQCKFCFAJIRRT-OVXNXNIRSA-N |
| SMILES | C/C(=C\COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)/C/C=C/C(C)(C)O |
Computed by PubChem (NCBI)