CAS 1443980-53-7 appears in our catalog under these names: 6-Methoxy-1,3-dimethyl-3,4-dihydroisoquinoline, 95%, 6-Methoxy-1,3-dimethyl-3,4-dihydroisoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-methoxy-1,3-dimethyl-3,4-dihydroisoquinoline (CAS 1443980-53-7) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 6-methoxy-1,3-dimethyl-3,4-dihydroisoquinoline. InChIKey: DXZAMPLVUDTVSM-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 6-methoxy-1,3-dimethyl-3,4-dihydroisoquinoline |
| InChIKey | DXZAMPLVUDTVSM-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C=CC(=C2)OC)C(=N1)C |
Computed by PubChem (NCBI)