CAS 1443981-04-1 appears in our catalog under these names: 3-Nitro-5,6,7,8-tetrahydroquinolin-6-amine dihydrochloride, 95%, 3-Nitro-5,6,7,8-tetrahydroquinolin-6-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-nitro-5,6,7,8-tetrahydroquinolin-6-amine;dihydrochloride (CAS 1443981-04-1) is a chemical compound with the molecular formula C9H13Cl2N3O2 and a molecular weight of 266.12 g/mol. IUPAC name: 3-nitro-5,6,7,8-tetrahydroquinolin-6-amine;dihydrochloride. InChIKey: RHUWDZPNSHZEFL-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3O2 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 3-nitro-5,6,7,8-tetrahydroquinolin-6-amine;dihydrochloride |
| InChIKey | RHUWDZPNSHZEFL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1N)C=C(C=N2)[N+](=O)[O-].Cl.Cl |
Computed by PubChem (NCBI)