CAS 381196-81-2 is the registry number for N-(2-Chloro-6-nitrophenyl)propane-1,3-diamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-(2-chloro-6-nitrophenyl)propane-1,3-diamine;hydrochloride (CAS 381196-81-2) is a chemical compound with the molecular formula C9H13Cl2N3O2 and a molecular weight of 266.12 g/mol. IUPAC name: N'-(2-chloro-6-nitrophenyl)propane-1,3-diamine;hydrochloride. InChIKey: ITUBOZSFRCUINC-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3O2 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | N'-(2-chloro-6-nitrophenyl)propane-1,3-diamine;hydrochloride |
| InChIKey | ITUBOZSFRCUINC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NCCCN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)