CAS 1444025-85-7 appears in our catalog under these names: 9-Amino-6-oxa-2-thiaspiro(4.5)decane 2,2-dioxide hydrochloride, 98%, 6-​Oxa-​2-​thiaspiro(4.5)​decan-​9-​amine 2,​2-​dioxide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
2,2-dioxo-6-oxa-2lambda6-thiaspiro[4.5]decan-9-amine;hydrochloride (CAS 1444025-85-7) is a chemical compound with the molecular formula C8H16ClNO3S and a molecular weight of 241.74 g/mol. IUPAC name: 2,2-dioxo-6-oxa-2lambda6-thiaspiro[4.5]decan-9-amine;hydrochloride. InChIKey: YNELMAQQRJSNLW-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO3S |
|---|---|
| Molecular weight | 241.74 g/mol |
| IUPAC name | 2,2-dioxo-6-oxa-2lambda6-thiaspiro[4.5]decan-9-amine;hydrochloride |
| InChIKey | YNELMAQQRJSNLW-UHFFFAOYSA-N |
| SMILES | C1COC2(CCS(=O)(=O)C2)CC1N.Cl |
Computed by PubChem (NCBI)