CAS 2137535-19-2 is the registry number for 4-Amino-1-oxa-8-thiaspiro(4.5)decane 8,8-dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8,8-dioxo-1-oxa-8lambda6-thiaspiro[4.5]decan-4-amine;hydrochloride (CAS 2137535-19-2) is a chemical compound with the molecular formula C8H16ClNO3S and a molecular weight of 241.74 g/mol. IUPAC name: 8,8-dioxo-1-oxa-8lambda6-thiaspiro[4.5]decan-4-amine;hydrochloride. InChIKey: GRTNUQLIGYDTPD-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO3S |
|---|---|
| Molecular weight | 241.74 g/mol |
| IUPAC name | 8,8-dioxo-1-oxa-8lambda6-thiaspiro[4.5]decan-4-amine;hydrochloride |
| InChIKey | GRTNUQLIGYDTPD-UHFFFAOYSA-N |
| SMILES | C1COC2(C1N)CCS(=O)(=O)CC2.Cl |
Computed by PubChem (NCBI)