CAS 144413-58-1 appears in our catalog under these names: Poly({9,9-dioctylfluorenyl-2,7-diyl}-co-{1,4-(2,5-dimethoxy)benzene}) end capped with dimethylphenyl, Anthra(2,3–b:6,7–b')dithiophene. Offered by: Lumtec, GLPBio. Available pack sizes: On request, 1g.
6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,17,19-nonaene (CAS 144413-58-1) is a chemical compound with the molecular formula C18H10S2 and a molecular weight of 290.4 g/mol. IUPAC name: 6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,17,19-nonaene. InChIKey: DAMUWSYTQPWFIY-UHFFFAOYSA-N.
| Molecular formula | C18H10S2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,17,19-nonaene |
| InChIKey | DAMUWSYTQPWFIY-UHFFFAOYSA-N |
| SMILES | C1=CSC2=CC3=CC4=C(C=C3C=C21)C=C5C(=C4)C=CS5 |
Computed by PubChem (NCBI)