Products 2701595-07-3
CAS 2701595-07-3 is the registry number for 2,2'-(2,5-Diethynyl-1,4-phenylene)dithiophene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,5-diethynyl-4-thiophen-2-ylphenyl)thiophene (CAS 2701595-07-3) is a chemical compound with the molecular formula C18H10S2 and a molecular weight of 290.4 g/mol. IUPAC name: 2-(2,5-diethynyl-4-thiophen-2-ylphenyl)thiophene. InChIKey: ZTTWIKUAZRGCDF-UHFFFAOYSA-N.
| Molecular formula | C18H10S2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 2-(2,5-diethynyl-4-thiophen-2-ylphenyl)thiophene |
| InChIKey | ZTTWIKUAZRGCDF-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1C2=CC=CS2)C#C)C3=CC=CS3 |
Computed by PubChem (NCBI)