Products 1444302-83-3
CAS 1444302-83-3 is the registry number for 1-(4-Chloro-2-fluorophenyl)-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
1-(4-chloro-2-fluorophenyl)pyrazole (CAS 1444302-83-3) is a chemical compound with the molecular formula C9H6ClFN2 and a molecular weight of 196.61 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)pyrazole. InChIKey: QVUKCOJXRSREAG-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2 |
|---|---|
| Molecular weight | 196.61 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)pyrazole |
| InChIKey | QVUKCOJXRSREAG-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=C(C=C(C=C2)Cl)F |
Computed by PubChem (NCBI)