CAS 928665-23-0 appears in our catalog under these names: 1-Chloro-4-fluoroisoquinolin-5-amine, 95%, 1-Chloro-4-fluoroisoquinolin-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
1-chloro-4-fluoroisoquinolin-5-amine (CAS 928665-23-0) is a chemical compound with the molecular formula C9H6ClFN2 and a molecular weight of 196.61 g/mol. IUPAC name: 1-chloro-4-fluoroisoquinolin-5-amine. InChIKey: FREJADUBOVLVNP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2 |
|---|---|
| Molecular weight | 196.61 g/mol |
| IUPAC name | 1-chloro-4-fluoroisoquinolin-5-amine |
| InChIKey | FREJADUBOVLVNP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=CN=C2Cl)F |
Computed by PubChem (NCBI)