Products 1444357-44-1
CAS 1444357-44-1 is the registry number for 2-(Chloromethyl)-8-fluoro-4-methylquinazoline, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(chloromethyl)-8-fluoro-4-methylquinazoline (CAS 1444357-44-1) is a chemical compound with the molecular formula C10H8ClFN2 and a molecular weight of 210.63 g/mol. IUPAC name: 2-(chloromethyl)-8-fluoro-4-methylquinazoline. InChIKey: GEMNIICQKNLRLS-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFN2 |
|---|---|
| Molecular weight | 210.63 g/mol |
| IUPAC name | 2-(chloromethyl)-8-fluoro-4-methylquinazoline |
| InChIKey | GEMNIICQKNLRLS-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC=C(C2=NC(=N1)CCl)F |
Computed by PubChem (NCBI)