CAS 1445322-50-8 is the registry number for 2-Bromo-1-methanesulfonyl-4-(trifluoromethoxy)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-1-methylsulfonyl-4-(trifluoromethoxy)benzene (CAS 1445322-50-8) is a chemical compound with the molecular formula C8H6BrF3O3S and a molecular weight of 319.10 g/mol. IUPAC name: 2-bromo-1-methylsulfonyl-4-(trifluoromethoxy)benzene. InChIKey: PVBDKHOYTORIOG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O3S |
|---|---|
| Molecular weight | 319.10 g/mol |
| IUPAC name | 2-bromo-1-methylsulfonyl-4-(trifluoromethoxy)benzene |
| InChIKey | PVBDKHOYTORIOG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)