CAS 1820716-91-3 is the registry number for 2-Bromo-6-methylphenyl triflate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-bromo-6-methylphenyl) trifluoromethanesulfonate (CAS 1820716-91-3) is a chemical compound with the molecular formula C8H6BrF3O3S and a molecular weight of 319.10 g/mol. IUPAC name: (2-bromo-6-methylphenyl) trifluoromethanesulfonate. InChIKey: ICZZDWXQFJBDKL-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O3S |
|---|---|
| Molecular weight | 319.10 g/mol |
| IUPAC name | (2-bromo-6-methylphenyl) trifluoromethanesulfonate |
| InChIKey | ICZZDWXQFJBDKL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Br)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)