CAS 1445569-01-6 is the registry number for 4,5-Dihydro-4-methyl-5-(4-methylphenyl)-2-Oxazolamine. Offered by: TRC. Available pack sizes: 100mg.
4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine (CAS 1445569-01-6) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine. InChIKey: NPILLHMQNMXXTL-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| InChIKey | NPILLHMQNMXXTL-UHFFFAOYSA-N |
| SMILES | CC1C(OC(=N1)N)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)