CAS 1632031-39-0 is the registry number for cis-(±)-4,4’-Dimethylaminorex. Offered by: Lipomed. Available pack sizes: 50mg, 100mg, 10mg.
(4S,5R)-4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine (CAS 1632031-39-0) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: (4S,5R)-4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine. InChIKey: NPILLHMQNMXXTL-WPRPVWTQSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | (4S,5R)-4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| InChIKey | NPILLHMQNMXXTL-WPRPVWTQSA-N |
| SMILES | C[C@H]1[C@H](OC(=N1)N)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)