CAS 1445894-94-9 appears in our catalog under these names: 2-Chloro-4-isopropoxy-5-nitropyrimidine, 95%, 2–Chloro–4–isopropoxy–5–nitropyrimidine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 5g, 1g.
2-chloro-5-nitro-4-propan-2-yloxypyrimidine (CAS 1445894-94-9) is a chemical compound with the molecular formula C7H8ClN3O3 and a molecular weight of 217.61 g/mol. IUPAC name: 2-chloro-5-nitro-4-propan-2-yloxypyrimidine. InChIKey: OYNYBMBZNDNLHY-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O3 |
|---|---|
| Molecular weight | 217.61 g/mol |
| IUPAC name | 2-chloro-5-nitro-4-propan-2-yloxypyrimidine |
| InChIKey | OYNYBMBZNDNLHY-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=NC(=NC=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)